About 1-(2-bromo-5-fluorophenyl)-4,5-dimethyltriazole
1-(2-bromo-5-fluorophenyl)-4,5-dimethyltriazole (PubChem CID 58877867) has the molecular formula C10H9BrFN3
and a molecular weight of 270.11 g/mol. Its IUPAC name is 1-(2-bromo-5-fluorophenyl)-4,5-dimethyltriazole.
Molecular Properties
| Compound Name | 1-(2-bromo-5-fluorophenyl)-4,5-dimethyltriazole |
| PubChem CID | 58877867 |
| Molecular Formula | C10H9BrFN3 |
| Molecular Weight | 270.11 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | 1-(2-bromo-5-fluorophenyl)-4,5-dimethyltriazole |
| SMILES | Cc1nnn(-c2cc(F)ccc2Br)c1C |
| InChI | InChI=1S/C10H9BrFN3/c1-6-7(2)15(14-13-6)10-5-8(12)3-4-9(10)11/h3-5H,1-2H3 |
| InChIKey | VIGILTPEAMQJAQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.11 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-bromo-5-fluorophenyl)-4,5-dimethyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromo-5-fluorophenyl)-4,5-dimethyltriazole?
The IUPAC name of 1-(2-bromo-5-fluorophenyl)-4,5-dimethyltriazole (CID 58877867) is 1-(2-bromo-5-fluorophenyl)-4,5-dimethyltriazole.
What is the SMILES notation for 1-(2-bromo-5-fluorophenyl)-4,5-dimethyltriazole?
The canonical SMILES for 1-(2-bromo-5-fluorophenyl)-4,5-dimethyltriazole is Cc1nnn(-c2cc(F)ccc2Br)c1C.
What is the InChIKey of 1-(2-bromo-5-fluorophenyl)-4,5-dimethyltriazole?
The InChIKey is VIGILTPEAMQJAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrFN3/c1-6-7(2)15(14-13-6)10-5-8(12)3-4-9(10)11/h3-5H,1-2H3.
What are the key properties of 1-(2-bromo-5-fluorophenyl)-4,5-dimethyltriazole?
1-(2-bromo-5-fluorophenyl)-4,5-dimethyltriazole has a molecular weight of 270.11 g/mol, XLogP of 2.79, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromo-5-fluorophenyl)-4,5-dimethyltriazole is sourced from PubChem (CID 58877867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).