C19H20F3N5O — CID 58878053
4-[3-(trifluoromethyl)phenyl]-6-(3,3,4-trimethyl-4-oxidopiperazin-4-ium-1-yl)pyrimidine-2-carbonitrile (PubChem CID 58878053) has the molecular formula C19H20F3N5O and a molecular weight of 391.40 g/mol. Its IUPAC name is 4-[3-(trifluoromethyl)phenyl]-6-(3,3,4-trimethyl-4-oxidopiperazin-4-ium-1-yl)pyrimidine-2-carbonitrile.
| Compound Name | 4-[3-(trifluoromethyl)phenyl]-6-(3,3,4-trimethyl-4-oxidopiperazin-4-ium-1-yl)pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 58878053 |
| Molecular Formula | C19H20F3N5O |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 4-[3-(trifluoromethyl)phenyl]-6-(3,3,4-trimethyl-4-oxidopiperazin-4-ium-1-yl)pyrimidine-2-carbonitrile |
| SMILES | CC1(C)CN(c2cc(-c3cccc(C(F)(F)F)c3)nc(C#N)n2)CC[N+]1(C)[O-] |
| InChI | InChI=1S/C19H20F3N5O/c1-18(2)12-26(7-8-27(18,3)28)17-10-15(24-16(11-23)25-17)13-5-4-6-14(9-13)19(20,21)22/h4-6,9-10H,7-8,12H2,1-3H3 |
| InChIKey | SFXIZQQAGNEKME-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|