C14H14Cl2N6O — CID 58878116
4-chloro-1-[(6-chloro-4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]pyrazolo[5,4-d]pyrimidin-6-amine (PubChem CID 58878116) has the molecular formula C14H14Cl2N6O and a molecular weight of 353.21 g/mol. Its IUPAC name is 4-chloro-1-[(6-chloro-4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]pyrazolo[5,4-d]pyrimidin-6-amine.
| Compound Name | 4-chloro-1-[(6-chloro-4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]pyrazolo[5,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 58878116 |
| Molecular Formula | C14H14Cl2N6O |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 4-chloro-1-[(6-chloro-4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]pyrazolo[5,4-d]pyrimidin-6-amine |
| SMILES | COc1c(C)c(Cl)nc(Cn2ncc3c(Cl)nc(N)nc32)c1C |
| InChI | InChI=1S/C14H14Cl2N6O/c1-6-9(19-11(15)7(2)10(6)23-3)5-22-13-8(4-18-22)12(16)20-14(17)21-13/h4H,5H2,1-3H3,(H2,17,20,21) |
| InChIKey | JFQFIZJFVWLVSU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|