C14H23N7O — CID 58878213
5-methyl-2-[3-(4-methylpiperazin-1-yl)propylamino]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 58878213) has the molecular formula C14H23N7O and a molecular weight of 305.39 g/mol. Its IUPAC name is 5-methyl-2-[3-(4-methylpiperazin-1-yl)propylamino]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-methyl-2-[3-(4-methylpiperazin-1-yl)propylamino]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 58878213 |
| Molecular Formula | C14H23N7O |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 5-methyl-2-[3-(4-methylpiperazin-1-yl)propylamino]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1cc(=O)n2[nH]c(NCCCN3CCN(C)CC3)nc2n1 |
| InChI | InChI=1S/C14H23N7O/c1-11-10-12(22)21-14(16-11)17-13(18-21)15-4-3-5-20-8-6-19(2)7-9-20/h10H,3-9H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | YFVSXJIFFGWWLH-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 81.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|