C9H18N2O2S — CID 58878991
CID 58878991 (PubChem CID 58878991) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol.
| Compound Name | CID 58878991 |
|---|---|
| PubChem CID | 58878991 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | — |
| SMILES | [CH]CNS(=O)(=O)CCN(CC)C1CC1 |
| InChI | InChI=1S/C9H18N2O2S/c1-3-10-14(12,13)8-7-11(4-2)9-5-6-9/h1,9-10H,3-8H2,2H3 |
| InChIKey | NDRSSHSFAFATMK-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |