C10H4F12N2 — CID 58879034
2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)propanedinitrile (PubChem CID 58879034) has the molecular formula C10H4F12N2 and a molecular weight of 380.13 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)propanedinitrile.
| Compound Name | 2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)propanedinitrile |
|---|---|
| PubChem CID | 58879034 |
| Molecular Formula | C10H4F12N2 |
| Molecular Weight | 380.13 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)propanedinitrile |
| SMILES | N#CC(C#N)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H4F12N2/c11-5(12)7(15,16)9(19,20)10(21,22)8(17,18)6(13,14)1-4(2-23)3-24/h4-5H,1H2 |
| InChIKey | QOZDWKOQENVOEJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.13 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|