C42H44N2O4Si2 — CID 58879109
N-[4-[dimethoxy(methyl)silyl]phenyl]-4-[4-(N-[4-[dimethoxy(methyl)silyl]phenyl]anilino)phenyl]-N-phenylaniline (PubChem CID 58879109) has the molecular formula C42H44N2O4Si2 and a molecular weight of 697.00 g/mol. Its IUPAC name is N-[4-[dimethoxy(methyl)silyl]phenyl]-4-[4-(N-[4-[dimethoxy(methyl)silyl]phenyl]anilino)phenyl]-N-phenylaniline.
| Compound Name | N-[4-[dimethoxy(methyl)silyl]phenyl]-4-[4-(N-[4-[dimethoxy(methyl)silyl]phenyl]anilino)phenyl]-N-phenylaniline |
|---|---|
| PubChem CID | 58879109 |
| Molecular Formula | C42H44N2O4Si2 |
| Molecular Weight | 697.00 g/mol |
| Exact Mass | 696.28 |
| IUPAC Name | N-[4-[dimethoxy(methyl)silyl]phenyl]-4-[4-(N-[4-[dimethoxy(methyl)silyl]phenyl]anilino)phenyl]-N-phenylaniline |
| SMILES | CO[Si](C)(OC)c1ccc(N(c2ccccc2)c2ccc(-c3ccc(N(c4ccccc4)c4ccc([Si](C)(OC)OC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C42H44N2O4Si2/c1-45-49(5,46-2)41-29-25-39(26-30-41)43(35-13-9-7-10-14-35)37-21-17-33(18-22-37)34-19-23-38(24-20-34)44(36-15-11-8-12-16-36)40-27-31-42(32-28-40)50(6,47-3)48-4/h7-32H,1-6H3 |
| InChIKey | GPMMOBQNPYDEFF-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.00 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|