C18H24O4 — CID 588799
dimethyl 1,2-bis(2-methylprop-1-enyl)tricyclo[3.1.0.02,4]hexane-3,6-dicarboxylate (PubChem CID 588799) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is dimethyl 1,2-bis(2-methylprop-1-enyl)tricyclo[3.1.0.02,4]hexane-3,6-dicarboxylate.
| Compound Name | dimethyl 1,2-bis(2-methylprop-1-enyl)tricyclo[3.1.0.02,4]hexane-3,6-dicarboxylate |
|---|---|
| PubChem CID | 588799 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | dimethyl 1,2-bis(2-methylprop-1-enyl)tricyclo[3.1.0.02,4]hexane-3,6-dicarboxylate |
| SMILES | COC(=O)C1C2C3C(C(=O)OC)C3(C=C(C)C)C12C=C(C)C |
| InChI | InChI=1S/C18H24O4/c1-9(2)7-17-11(13(17)15(19)21-5)12-14(16(20)22-6)18(12,17)8-10(3)4/h7-8,11-14H,1-6H3 |
| InChIKey | XJRUTBMZWNXKDI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|