About [(2Z)-1-amino-4-ethoxycarbonylpenta-2,4-dienylidene]tungsten
[(2Z)-1-amino-4-ethoxycarbonylpenta-2,4-dienylidene]tungsten (PubChem CID 58879973) has the molecular formula C8H10NO2W-
and a molecular weight of 336.01 g/mol. Its IUPAC name is [(2Z)-1-amino-4-ethoxycarbonylpenta-2,4-dienylidene]tungsten.
Molecular Properties
| Compound Name | [(2Z)-1-amino-4-ethoxycarbonylpenta-2,4-dienylidene]tungsten |
| PubChem CID | 58879973 |
| Molecular Formula | C8H10NO2W- |
| Molecular Weight | 336.01 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | [(2Z)-1-amino-4-ethoxycarbonylpenta-2,4-dienylidene]tungsten |
| SMILES | [H]/[C-]=C(/C=C\C(N)=[W])C(=O)OCC |
| InChI | InChI=1S/C8H10NO2.W/c1-3-11-8(10)7(2)5-4-6-9;/h2,4-5H,3,9H2,1H3;/q-1;/b5-4-; |
| InChIKey | RYYNUHAOGDWEFS-MKWAYWHRSA-N |
| XLogP | 0.10 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.01 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(2Z)-1-amino-4-ethoxycarbonylpenta-2,4-dienylidene]tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z)-1-amino-4-ethoxycarbonylpenta-2,4-dienylidene]tungsten?
The IUPAC name of [(2Z)-1-amino-4-ethoxycarbonylpenta-2,4-dienylidene]tungsten (CID 58879973) is [(2Z)-1-amino-4-ethoxycarbonylpenta-2,4-dienylidene]tungsten.
What is the SMILES notation for [(2Z)-1-amino-4-ethoxycarbonylpenta-2,4-dienylidene]tungsten?
The canonical SMILES for [(2Z)-1-amino-4-ethoxycarbonylpenta-2,4-dienylidene]tungsten is [H]/[C-]=C(/C=C\C(N)=[W])C(=O)OCC.
What is the InChIKey of [(2Z)-1-amino-4-ethoxycarbonylpenta-2,4-dienylidene]tungsten?
The InChIKey is RYYNUHAOGDWEFS-MKWAYWHRSA-N. The full InChI is InChI=1S/C8H10NO2.W/c1-3-11-8(10)7(2)5-4-6-9;/h2,4-5H,3,9H2,1H3;/q-1;/b5-4-;.
What are the key properties of [(2Z)-1-amino-4-ethoxycarbonylpenta-2,4-dienylidene]tungsten?
[(2Z)-1-amino-4-ethoxycarbonylpenta-2,4-dienylidene]tungsten has a molecular weight of 336.01 g/mol, XLogP of 0.10, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-1-amino-4-ethoxycarbonylpenta-2,4-dienylidene]tungsten is sourced from PubChem (CID 58879973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).