C25H30N4O3S — CID 58880084
3-[8-[3-(dimethylamino)propoxy]-3-methyl-9H-pyrido[2,3-b]indol-5-yl]-N,N-dimethylbenzenesulfonamide (PubChem CID 58880084) has the molecular formula C25H30N4O3S and a molecular weight of 466.61 g/mol. Its IUPAC name is 3-[8-[3-(dimethylamino)propoxy]-3-methyl-9H-pyrido[2,3-b]indol-5-yl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-[8-[3-(dimethylamino)propoxy]-3-methyl-9H-pyrido[2,3-b]indol-5-yl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 58880084 |
| Molecular Formula | C25H30N4O3S |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 3-[8-[3-(dimethylamino)propoxy]-3-methyl-9H-pyrido[2,3-b]indol-5-yl]-N,N-dimethylbenzenesulfonamide |
| SMILES | Cc1cnc2[nH]c3c(OCCCN(C)C)ccc(-c4cccc(S(=O)(=O)N(C)C)c4)c3c2c1 |
| InChI | InChI=1S/C25H30N4O3S/c1-17-14-21-23-20(18-8-6-9-19(15-18)33(30,31)29(4)5)10-11-22(32-13-7-12-28(2)3)24(23)27-25(21)26-16-17/h6,8-11,14-16H,7,12-13H2,1-5H3,(H,26,27) |
| InChIKey | FGUMETUPJIPADX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|