C20H18ClN5O3S2 — CID 58880284
1-[3-[(4-aminoperoxysulfanyloxy-3-chlorophenyl)sulfanylmethyl]-5-(1,2,4-triazol-1-yl)phenyl]cyclobutane-1-carbonitrile (PubChem CID 58880284) has the molecular formula C20H18ClN5O3S2 and a molecular weight of 475.98 g/mol. Its IUPAC name is 1-[3-[(4-aminoperoxysulfanyloxy-3-chlorophenyl)sulfanylmethyl]-5-(1,2,4-triazol-1-yl)phenyl]cyclobutane-1-carbonitrile.
| Compound Name | 1-[3-[(4-aminoperoxysulfanyloxy-3-chlorophenyl)sulfanylmethyl]-5-(1,2,4-triazol-1-yl)phenyl]cyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 58880284 |
| Molecular Formula | C20H18ClN5O3S2 |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | 1-[3-[(4-aminoperoxysulfanyloxy-3-chlorophenyl)sulfanylmethyl]-5-(1,2,4-triazol-1-yl)phenyl]cyclobutane-1-carbonitrile |
| SMILES | N#CC1(c2cc(CSc3ccc(OSOON)c(Cl)c3)cc(-n3cncn3)c2)CCC1 |
| InChI | InChI=1S/C20H18ClN5O3S2/c21-18-9-17(2-3-19(18)27-31-29-28-23)30-10-14-6-15(20(11-22)4-1-5-20)8-16(7-14)26-13-24-12-25-26/h2-3,6-9,12-13H,1,4-5,10,23H2 |
| InChIKey | NLWSYIORVSVGMT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|