About (2S,5R)-2-methyl-5-(pyrrolidin-1-ylmethyl)-1,3-thiazolidine
(2S,5R)-2-methyl-5-(pyrrolidin-1-ylmethyl)-1,3-thiazolidine (PubChem CID 58880434) has the molecular formula C9H18N2S
and a molecular weight of 186.32 g/mol. Its IUPAC name is (2S,5R)-2-methyl-5-(pyrrolidin-1-ylmethyl)-1,3-thiazolidine.
Molecular Properties
| Compound Name | (2S,5R)-2-methyl-5-(pyrrolidin-1-ylmethyl)-1,3-thiazolidine |
| PubChem CID | 58880434 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | (2S,5R)-2-methyl-5-(pyrrolidin-1-ylmethyl)-1,3-thiazolidine |
| SMILES | C[C@H]1NC[C@H](CN2CCCC2)S1 |
| InChI | InChI=1S/C9H18N2S/c1-8-10-6-9(12-8)7-11-4-2-3-5-11/h8-10H,2-7H2,1H3/t8-,9+/m0/s1 |
| InChIKey | YCKQHJQEVWHJEB-DTWKUNHWSA-N |
| XLogP | 1.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,5R)-2-methyl-5-(pyrrolidin-1-ylmethyl)-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5R)-2-methyl-5-(pyrrolidin-1-ylmethyl)-1,3-thiazolidine?
The IUPAC name of (2S,5R)-2-methyl-5-(pyrrolidin-1-ylmethyl)-1,3-thiazolidine (CID 58880434) is (2S,5R)-2-methyl-5-(pyrrolidin-1-ylmethyl)-1,3-thiazolidine.
What is the SMILES notation for (2S,5R)-2-methyl-5-(pyrrolidin-1-ylmethyl)-1,3-thiazolidine?
The canonical SMILES for (2S,5R)-2-methyl-5-(pyrrolidin-1-ylmethyl)-1,3-thiazolidine is C[C@H]1NC[C@H](CN2CCCC2)S1.
What is the InChIKey of (2S,5R)-2-methyl-5-(pyrrolidin-1-ylmethyl)-1,3-thiazolidine?
The InChIKey is YCKQHJQEVWHJEB-DTWKUNHWSA-N. The full InChI is InChI=1S/C9H18N2S/c1-8-10-6-9(12-8)7-11-4-2-3-5-11/h8-10H,2-7H2,1H3/t8-,9+/m0/s1.
What are the key properties of (2S,5R)-2-methyl-5-(pyrrolidin-1-ylmethyl)-1,3-thiazolidine?
(2S,5R)-2-methyl-5-(pyrrolidin-1-ylmethyl)-1,3-thiazolidine has a molecular weight of 186.32 g/mol, XLogP of 1.13, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5R)-2-methyl-5-(pyrrolidin-1-ylmethyl)-1,3-thiazolidine is sourced from PubChem (CID 58880434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).