About 3-ethyl-1,3,5-oxadiazinan-4-one
3-ethyl-1,3,5-oxadiazinan-4-one (PubChem CID 58880533) has the molecular formula C5H10N2O2
and a molecular weight of 130.15 g/mol. Its IUPAC name is 3-ethyl-1,3,5-oxadiazinan-4-one.
Molecular Properties
| Compound Name | 3-ethyl-1,3,5-oxadiazinan-4-one |
| PubChem CID | 58880533 |
| Molecular Formula | C5H10N2O2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.07 |
| IUPAC Name | 3-ethyl-1,3,5-oxadiazinan-4-one |
| SMILES | CCN1COCNC1=O |
| InChI | InChI=1S/C5H10N2O2/c1-2-7-4-9-3-6-5(7)8/h2-4H2,1H3,(H,6,8) |
| InChIKey | NUBSHJVDSJEZTG-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-1,3,5-oxadiazinan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,3,5-oxadiazinan-4-one?
The IUPAC name of 3-ethyl-1,3,5-oxadiazinan-4-one (CID 58880533) is 3-ethyl-1,3,5-oxadiazinan-4-one.
What is the SMILES notation for 3-ethyl-1,3,5-oxadiazinan-4-one?
The canonical SMILES for 3-ethyl-1,3,5-oxadiazinan-4-one is CCN1COCNC1=O.
What is the InChIKey of 3-ethyl-1,3,5-oxadiazinan-4-one?
The InChIKey is NUBSHJVDSJEZTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O2/c1-2-7-4-9-3-6-5(7)8/h2-4H2,1H3,(H,6,8).
What are the key properties of 3-ethyl-1,3,5-oxadiazinan-4-one?
3-ethyl-1,3,5-oxadiazinan-4-one has a molecular weight of 130.15 g/mol, XLogP of -0.04, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,3,5-oxadiazinan-4-one is sourced from PubChem (CID 58880533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).