C5H10N2O2 — CID 58880534
2,6-dimethyl-1,3,5-oxadiazinan-4-one (PubChem CID 58880534) has the molecular formula C5H10N2O2 and a molecular weight of 130.15 g/mol. Its IUPAC name is 2,6-dimethyl-1,3,5-oxadiazinan-4-one.
| Compound Name | 2,6-dimethyl-1,3,5-oxadiazinan-4-one |
|---|---|
| PubChem CID | 58880534 |
| Molecular Formula | C5H10N2O2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.07 |
| IUPAC Name | 2,6-dimethyl-1,3,5-oxadiazinan-4-one |
| SMILES | CC1NC(=O)NC(C)O1 |
| InChI | InChI=1S/C5H10N2O2/c1-3-6-5(8)7-4(2)9-3/h3-4H,1-2H3,(H2,6,7,8) |
| InChIKey | NPQGLLXEDVWUPS-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |