About 5-ethyl-2-methyl-1,3,5-oxadiazinan-4-one
5-ethyl-2-methyl-1,3,5-oxadiazinan-4-one (PubChem CID 58880536) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is 5-ethyl-2-methyl-1,3,5-oxadiazinan-4-one.
Molecular Properties
| Compound Name | 5-ethyl-2-methyl-1,3,5-oxadiazinan-4-one |
| PubChem CID | 58880536 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 5-ethyl-2-methyl-1,3,5-oxadiazinan-4-one |
| SMILES | CCN1COC(C)NC1=O |
| InChI | InChI=1S/C6H12N2O2/c1-3-8-4-10-5(2)7-6(8)9/h5H,3-4H2,1-2H3,(H,7,9) |
| InChIKey | JTXLYDOVANGLHD-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-2-methyl-1,3,5-oxadiazinan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-methyl-1,3,5-oxadiazinan-4-one?
The IUPAC name of 5-ethyl-2-methyl-1,3,5-oxadiazinan-4-one (CID 58880536) is 5-ethyl-2-methyl-1,3,5-oxadiazinan-4-one.
What is the SMILES notation for 5-ethyl-2-methyl-1,3,5-oxadiazinan-4-one?
The canonical SMILES for 5-ethyl-2-methyl-1,3,5-oxadiazinan-4-one is CCN1COC(C)NC1=O.
What is the InChIKey of 5-ethyl-2-methyl-1,3,5-oxadiazinan-4-one?
The InChIKey is JTXLYDOVANGLHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2/c1-3-8-4-10-5(2)7-6(8)9/h5H,3-4H2,1-2H3,(H,7,9).
What are the key properties of 5-ethyl-2-methyl-1,3,5-oxadiazinan-4-one?
5-ethyl-2-methyl-1,3,5-oxadiazinan-4-one has a molecular weight of 144.17 g/mol, XLogP of 0.35, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-methyl-1,3,5-oxadiazinan-4-one is sourced from PubChem (CID 58880536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).