C23H25N5 — CID 58880700
2-(4-tert-butylphenyl)-N-(2,4-dimethylphenyl)-6-methylpyrazolo[1,5-b][1,2,4]triazol-7-imine (PubChem CID 58880700) has the molecular formula C23H25N5 and a molecular weight of 371.49 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-N-(2,4-dimethylphenyl)-6-methylpyrazolo[1,5-b][1,2,4]triazol-7-imine.
| Compound Name | 2-(4-tert-butylphenyl)-N-(2,4-dimethylphenyl)-6-methylpyrazolo[1,5-b][1,2,4]triazol-7-imine |
|---|---|
| PubChem CID | 58880700 |
| Molecular Formula | C23H25N5 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 2-(4-tert-butylphenyl)-N-(2,4-dimethylphenyl)-6-methylpyrazolo[1,5-b][1,2,4]triazol-7-imine |
| SMILES | CC1=Nn2nc(-c3ccc(C(C)(C)C)cc3)nc2/C1=N/c1ccc(C)cc1C |
| InChI | InChI=1S/C23H25N5/c1-14-7-12-19(15(2)13-14)24-20-16(3)26-28-22(20)25-21(27-28)17-8-10-18(11-9-17)23(4,5)6/h7-13H,1-6H3/b24-20+ |
| InChIKey | ZZFIHAKLMHGWIY-HIXSDJFHSA-N |
| XLogP | 5.22 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|