C72H54 — CID 58880913
2-(3,5-diphenylphenyl)-7-[4-[7-(3,5-diphenylphenyl)-9,9-dimethylfluoren-2-yl]phenyl]-9,9-dimethylfluorene (PubChem CID 58880913) has the molecular formula C72H54 and a molecular weight of 919.22 g/mol. Its IUPAC name is 2-(3,5-diphenylphenyl)-7-[4-[7-(3,5-diphenylphenyl)-9,9-dimethylfluoren-2-yl]phenyl]-9,9-dimethylfluorene.
| Compound Name | 2-(3,5-diphenylphenyl)-7-[4-[7-(3,5-diphenylphenyl)-9,9-dimethylfluoren-2-yl]phenyl]-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 58880913 |
| Molecular Formula | C72H54 |
| Molecular Weight | 919.22 g/mol |
| Exact Mass | 918.42 |
| IUPAC Name | 2-(3,5-diphenylphenyl)-7-[4-[7-(3,5-diphenylphenyl)-9,9-dimethylfluoren-2-yl]phenyl]-9,9-dimethylfluorene |
| SMILES | CC1(C)c2cc(-c3ccc(-c4ccc5c(c4)C(C)(C)c4cc(-c6cc(-c7ccccc7)cc(-c7ccccc7)c6)ccc4-5)cc3)ccc2-c2ccc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)cc21 |
| InChI | InChI=1S/C72H54/c1-71(2)67-43-53(29-33-63(67)65-35-31-55(45-69(65)71)61-39-57(47-17-9-5-10-18-47)37-58(40-61)48-19-11-6-12-20-48)51-25-27-52(28-26-51)54-30-34-64-66-36-32-56(46-70(66)72(3,4)68(64)44-54)62-41-59(49-21-13-7-14-22-49)38-60(42-62)50-23-15-8-16-24-50/h5-46H,1-4H3 |
| InChIKey | AZORKHOVNDBNPS-UHFFFAOYSA-N |
| XLogP | 19.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.22 |
| LogP ≤ 5 | 19.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |