C89H66 — CID 58881057
2,7-bis[9,9-dimethyl-7-[3-(4-naphthalen-1-ylphenyl)phenyl]fluoren-2-yl]-9,9-dimethylfluorene (PubChem CID 58881057) has the molecular formula C89H66 and a molecular weight of 1135.51 g/mol. Its IUPAC name is 2,7-bis[9,9-dimethyl-7-[3-(4-naphthalen-1-ylphenyl)phenyl]fluoren-2-yl]-9,9-dimethylfluorene.
| Compound Name | 2,7-bis[9,9-dimethyl-7-[3-(4-naphthalen-1-ylphenyl)phenyl]fluoren-2-yl]-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 58881057 |
| Molecular Formula | C89H66 |
| Molecular Weight | 1135.51 g/mol |
| Exact Mass | 1134.52 |
| IUPAC Name | 2,7-bis[9,9-dimethyl-7-[3-(4-naphthalen-1-ylphenyl)phenyl]fluoren-2-yl]-9,9-dimethylfluorene |
| SMILES | CC1(C)c2cc(-c3cccc(-c4ccc(-c5cccc6ccccc56)cc4)c3)ccc2-c2ccc(-c3ccc4c(c3)C(C)(C)c3cc(-c5ccc6c(c5)C(C)(C)c5cc(-c7cccc(-c8ccc(-c9cccc%10ccccc9%10)cc8)c7)ccc5-6)ccc3-4)cc21 |
| InChI | InChI=1S/C89H66/c1-87(2)81-49-65(63-21-11-19-61(47-63)55-27-31-59(32-28-55)73-25-13-17-57-15-7-9-23-71(57)73)35-41-75(81)77-43-37-67(51-83(77)87)69-39-45-79-80-46-40-70(54-86(80)89(5,6)85(79)53-69)68-38-44-78-76-42-36-66(50-82(76)88(3,4)84(78)52-68)64-22-12-20-62(48-64)56-29-33-60(34-30-56)74-26-14-18-58-16-8-10-24-72(58)74/h7-54H,1-6H3 |
| InChIKey | CWRKZWFKQOEKBK-UHFFFAOYSA-N |
| XLogP | 24.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 89 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1135.51 |
| LogP ≤ 5 | 24.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |