C49H41BN2O2 — CID 58881205
[7-[7-(9,9-dimethyl-7-pyrimidin-2-ylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-9,9-dimethylfluoren-2-yl]boronic acid (PubChem CID 58881205) has the molecular formula C49H41BN2O2 and a molecular weight of 700.69 g/mol. Its IUPAC name is [7-[7-(9,9-dimethyl-7-pyrimidin-2-ylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-9,9-dimethylfluoren-2-yl]boronic acid.
| Compound Name | [7-[7-(9,9-dimethyl-7-pyrimidin-2-ylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-9,9-dimethylfluoren-2-yl]boronic acid |
|---|---|
| PubChem CID | 58881205 |
| Molecular Formula | C49H41BN2O2 |
| Molecular Weight | 700.69 g/mol |
| Exact Mass | 700.33 |
| IUPAC Name | [7-[7-(9,9-dimethyl-7-pyrimidin-2-ylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-9,9-dimethylfluoren-2-yl]boronic acid |
| SMILES | CC1(C)c2cc(B(O)O)ccc2-c2ccc(-c3ccc4c(c3)C(C)(C)c3cc(-c5ccc6c(c5)C(C)(C)c5cc(-c7ncccn7)ccc5-6)ccc3-4)cc21 |
| InChI | InChI=1S/C49H41BN2O2/c1-47(2)40-22-28(30-10-16-36-38-18-12-32(46-51-20-7-21-52-46)26-44(38)48(3,4)42(36)24-30)8-14-34(40)35-15-9-29(23-41(35)47)31-11-17-37-39-19-13-33(50(53)54)27-45(39)49(5,6)43(37)25-31/h7-27,53-54H,1-6H3 |
| InChIKey | AZMSBGBHOYNMSK-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.69 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|