C17H24F6O2 — CID 58881392
(3,3,4,4,6,6-hexafluoro-2-methylhexan-2-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 58881392) has the molecular formula C17H24F6O2 and a molecular weight of 374.37 g/mol. Its IUPAC name is (3,3,4,4,6,6-hexafluoro-2-methylhexan-2-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | (3,3,4,4,6,6-hexafluoro-2-methylhexan-2-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 58881392 |
| Molecular Formula | C17H24F6O2 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (3,3,4,4,6,6-hexafluoro-2-methylhexan-2-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC1C2CC(C(=O)OC(C)(C)C(F)(F)C(F)(F)CC(F)F)C(C2)C1C |
| InChI | InChI=1S/C17H24F6O2/c1-8-9(2)11-5-10(8)6-12(11)14(24)25-15(3,4)17(22,23)16(20,21)7-13(18)19/h8-13H,5-7H2,1-4H3 |
| InChIKey | SKCSHMYOPAVZOP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|