C12H18F6O2 — CID 58881426
(3,3,4,4,6,6-hexafluoro-2-methylhexan-2-yl) 2-methylbutanoate (PubChem CID 58881426) has the molecular formula C12H18F6O2 and a molecular weight of 308.26 g/mol. Its IUPAC name is (3,3,4,4,6,6-hexafluoro-2-methylhexan-2-yl) 2-methylbutanoate.
| Compound Name | (3,3,4,4,6,6-hexafluoro-2-methylhexan-2-yl) 2-methylbutanoate |
|---|---|
| PubChem CID | 58881426 |
| Molecular Formula | C12H18F6O2 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (3,3,4,4,6,6-hexafluoro-2-methylhexan-2-yl) 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC(C)(C)C(F)(F)C(F)(F)CC(F)F |
| InChI | InChI=1S/C12H18F6O2/c1-5-7(2)9(19)20-10(3,4)12(17,18)11(15,16)6-8(13)14/h7-8H,5-6H2,1-4H3 |
| InChIKey | XIPPTWNZZSSKNI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|