C13H14F10O5 — CID 58881444
[2-[4-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-hydroxypentan-2-yl]oxy-2-oxoethyl] 2-methylbutanoate (PubChem CID 58881444) has the molecular formula C13H14F10O5 and a molecular weight of 440.23 g/mol. Its IUPAC name is [2-[4-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-hydroxypentan-2-yl]oxy-2-oxoethyl] 2-methylbutanoate.
| Compound Name | [2-[4-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-hydroxypentan-2-yl]oxy-2-oxoethyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 58881444 |
| Molecular Formula | C13H14F10O5 |
| Molecular Weight | 440.23 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | [2-[4-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-hydroxypentan-2-yl]oxy-2-oxoethyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCC(=O)OC(C(F)(F)F)C(F)(F)C(O)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H14F10O5/c1-3-5(2)7(25)27-4-6(24)28-8(12(18,19)20)11(16,17)10(26,9(14)15)13(21,22)23/h5,8-9,26H,3-4H2,1-2H3 |
| InChIKey | TYBADKMUPSFKQZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.23 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |