C18H26F6O2 — CID 58881490
(4,4,5,5,7,7-hexafluoro-2-methylheptan-2-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 58881490) has the molecular formula C18H26F6O2 and a molecular weight of 388.39 g/mol. Its IUPAC name is (4,4,5,5,7,7-hexafluoro-2-methylheptan-2-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | (4,4,5,5,7,7-hexafluoro-2-methylheptan-2-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 58881490 |
| Molecular Formula | C18H26F6O2 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (4,4,5,5,7,7-hexafluoro-2-methylheptan-2-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC1C2CC(C(=O)OC(C)(C)CC(F)(F)C(F)(F)CC(F)F)C(C2)C1C |
| InChI | InChI=1S/C18H26F6O2/c1-9-10(2)12-5-11(9)6-13(12)15(25)26-16(3,4)8-18(23,24)17(21,22)7-14(19)20/h9-14H,5-8H2,1-4H3 |
| InChIKey | OSLIAZSAOMUAPA-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|