About (5S)-5-(ethoxymethyl)-3,3-difluoro-2-hydroxy-1,2λ5-oxaphospholane 2-oxide
(5S)-5-(ethoxymethyl)-3,3-difluoro-2-hydroxy-1,2λ5-oxaphospholane 2-oxide (PubChem CID 58881727) has the molecular formula C6H11F2O4P
and a molecular weight of 216.12 g/mol. Its IUPAC name is (5S)-5-(ethoxymethyl)-3,3-difluoro-2-hydroxy-1,2λ5-oxaphospholane 2-oxide.
Molecular Properties
| Compound Name | (5S)-5-(ethoxymethyl)-3,3-difluoro-2-hydroxy-1,2λ5-oxaphospholane 2-oxide |
| PubChem CID | 58881727 |
| Molecular Formula | C6H11F2O4P |
| Molecular Weight | 216.12 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | (5S)-5-(ethoxymethyl)-3,3-difluoro-2-hydroxy-1,2λ5-oxaphospholane 2-oxide |
| SMILES | CCOC[C@@H]1CC(F)(F)P(=O)(O)O1 |
| InChI | InChI=1S/C6H11F2O4P/c1-2-11-4-5-3-6(7,8)13(9,10)12-5/h5H,2-4H2,1H3,(H,9,10)/t5-/m0/s1 |
| InChIKey | NOWCINKKDPGKEC-YFKPBYRVSA-N |
| XLogP | 1.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.12 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-(ethoxymethyl)-3,3-difluoro-2-hydroxy-1,2λ5-oxaphospholane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-(ethoxymethyl)-3,3-difluoro-2-hydroxy-1,2λ5-oxaphospholane 2-oxide?
The IUPAC name of (5S)-5-(ethoxymethyl)-3,3-difluoro-2-hydroxy-1,2λ5-oxaphospholane 2-oxide (CID 58881727) is (5S)-5-(ethoxymethyl)-3,3-difluoro-2-hydroxy-1,2λ5-oxaphospholane 2-oxide.
What is the SMILES notation for (5S)-5-(ethoxymethyl)-3,3-difluoro-2-hydroxy-1,2λ5-oxaphospholane 2-oxide?
The canonical SMILES for (5S)-5-(ethoxymethyl)-3,3-difluoro-2-hydroxy-1,2λ5-oxaphospholane 2-oxide is CCOC[C@@H]1CC(F)(F)P(=O)(O)O1.
What is the InChIKey of (5S)-5-(ethoxymethyl)-3,3-difluoro-2-hydroxy-1,2λ5-oxaphospholane 2-oxide?
The InChIKey is NOWCINKKDPGKEC-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H11F2O4P/c1-2-11-4-5-3-6(7,8)13(9,10)12-5/h5H,2-4H2,1H3,(H,9,10)/t5-/m0/s1.
What are the key properties of (5S)-5-(ethoxymethyl)-3,3-difluoro-2-hydroxy-1,2λ5-oxaphospholane 2-oxide?
(5S)-5-(ethoxymethyl)-3,3-difluoro-2-hydroxy-1,2λ5-oxaphospholane 2-oxide has a molecular weight of 216.12 g/mol, XLogP of 1.59, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-(ethoxymethyl)-3,3-difluoro-2-hydroxy-1,2λ5-oxaphospholane 2-oxide is sourced from PubChem (CID 58881727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).