C23H20FN5O2 — CID 58881788
1-ethyl-3-[3-(3-fluoro-4-phenylmethoxyphenyl)pyrido[2,3-b]pyrazin-6-yl]urea (PubChem CID 58881788) has the molecular formula C23H20FN5O2 and a molecular weight of 417.44 g/mol. Its IUPAC name is 1-ethyl-3-[3-(3-fluoro-4-phenylmethoxyphenyl)pyrido[2,3-b]pyrazin-6-yl]urea.
| Compound Name | 1-ethyl-3-[3-(3-fluoro-4-phenylmethoxyphenyl)pyrido[2,3-b]pyrazin-6-yl]urea |
|---|---|
| PubChem CID | 58881788 |
| Molecular Formula | C23H20FN5O2 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 1-ethyl-3-[3-(3-fluoro-4-phenylmethoxyphenyl)pyrido[2,3-b]pyrazin-6-yl]urea |
| SMILES | CCNC(=O)Nc1ccc2ncc(-c3ccc(OCc4ccccc4)c(F)c3)nc2n1 |
| InChI | InChI=1S/C23H20FN5O2/c1-2-25-23(30)29-21-11-9-18-22(28-21)27-19(13-26-18)16-8-10-20(17(24)12-16)31-14-15-6-4-3-5-7-15/h3-13H,2,14H2,1H3,(H2,25,27,28,29,30) |
| InChIKey | BQVLHRBRLIDQLO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |