C17H16FN5O2 — CID 58881794
1-ethyl-3-[3-(3-fluoro-4-methoxyphenyl)pyrido[2,3-b]pyrazin-6-yl]urea (PubChem CID 58881794) has the molecular formula C17H16FN5O2 and a molecular weight of 341.35 g/mol. Its IUPAC name is 1-ethyl-3-[3-(3-fluoro-4-methoxyphenyl)pyrido[2,3-b]pyrazin-6-yl]urea.
| Compound Name | 1-ethyl-3-[3-(3-fluoro-4-methoxyphenyl)pyrido[2,3-b]pyrazin-6-yl]urea |
|---|---|
| PubChem CID | 58881794 |
| Molecular Formula | C17H16FN5O2 |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 1-ethyl-3-[3-(3-fluoro-4-methoxyphenyl)pyrido[2,3-b]pyrazin-6-yl]urea |
| SMILES | CCNC(=O)Nc1ccc2ncc(-c3ccc(OC)c(F)c3)nc2n1 |
| InChI | InChI=1S/C17H16FN5O2/c1-3-19-17(24)23-15-7-5-12-16(22-15)21-13(9-20-12)10-4-6-14(25-2)11(18)8-10/h4-9H,3H2,1-2H3,(H2,19,21,22,23,24) |
| InChIKey | UOJHSQWQQKZQDI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |