About [4-[6-(prop-2-enylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 4-(dimethylamino)benzoate
[4-[6-(prop-2-enylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 4-(dimethylamino)benzoate (PubChem CID 58881909) has the molecular formula C26H24N6O3
and a molecular weight of 468.52 g/mol. Its IUPAC name is [4-[6-(prop-2-enylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 4-(dimethylamino)benzoate.
Molecular Properties
| Compound Name | [4-[6-(prop-2-enylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 4-(dimethylamino)benzoate |
| PubChem CID | 58881909 |
| Molecular Formula | C26H24N6O3 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | [4-[6-(prop-2-enylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 4-(dimethylamino)benzoate |
| SMILES | C=CCNC(=O)Nc1ccc2ncc(-c3ccc(OC(=O)c4ccc(N(C)C)cc4)cc3)nc2n1 |
| InChI | InChI=1S/C26H24N6O3/c1-4-15-27-26(34)31-23-14-13-21-24(30-23)29-22(16-28-21)17-7-11-20(12-8-17)35-25(33)18-5-9-19(10-6-18)32(2)3/h4-14,16H,1,15H2,2-3H3,(H2,27,29,30,31,34) |
| InChIKey | FYQGFJOVZHXMBU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[6-(prop-2-enylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 4-(dimethylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[6-(prop-2-enylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 4-(dimethylamino)benzoate?
The IUPAC name of [4-[6-(prop-2-enylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 4-(dimethylamino)benzoate (CID 58881909) is [4-[6-(prop-2-enylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 4-(dimethylamino)benzoate.
What is the SMILES notation for [4-[6-(prop-2-enylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 4-(dimethylamino)benzoate?
The canonical SMILES for [4-[6-(prop-2-enylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 4-(dimethylamino)benzoate is C=CCNC(=O)Nc1ccc2ncc(-c3ccc(OC(=O)c4ccc(N(C)C)cc4)cc3)nc2n1.
What is the InChIKey of [4-[6-(prop-2-enylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 4-(dimethylamino)benzoate?
The InChIKey is FYQGFJOVZHXMBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24N6O3/c1-4-15-27-26(34)31-23-14-13-21-24(30-23)29-22(16-28-21)17-7-11-20(12-8-17)35-25(33)18-5-9-19(10-6-18)32(2)3/h4-14,16H,1,15H2,2-3H3,(H2,27,29,30,31,34).
What are the key properties of [4-[6-(prop-2-enylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 4-(dimethylamino)benzoate?
[4-[6-(prop-2-enylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 4-(dimethylamino)benzoate has a molecular weight of 468.52 g/mol, XLogP of 4.28, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[6-(prop-2-enylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 4-(dimethylamino)benzoate is sourced from PubChem (CID 58881909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).