C18H20N6O — CID 58881935
1-[3-(3,5-dimethylanilino)pyrido[2,3-b]pyrazin-6-yl]-3-ethylurea (PubChem CID 58881935) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylanilino)pyrido[2,3-b]pyrazin-6-yl]-3-ethylurea.
| Compound Name | 1-[3-(3,5-dimethylanilino)pyrido[2,3-b]pyrazin-6-yl]-3-ethylurea |
|---|---|
| PubChem CID | 58881935 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 1-[3-(3,5-dimethylanilino)pyrido[2,3-b]pyrazin-6-yl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1ccc2ncc(Nc3cc(C)cc(C)c3)nc2n1 |
| InChI | InChI=1S/C18H20N6O/c1-4-19-18(25)24-15-6-5-14-17(22-15)23-16(10-20-14)21-13-8-11(2)7-12(3)9-13/h5-10H,4H2,1-3H3,(H3,19,21,22,23,24,25) |
| InChIKey | DZPMZKTXZSKATK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |