About 4-hydroxy-1,5,6-trimethyl-3-[(E)-3-(3-methylphenyl)prop-2-enoyl]pyridin-2-one
4-hydroxy-1,5,6-trimethyl-3-[(E)-3-(3-methylphenyl)prop-2-enoyl]pyridin-2-one (PubChem CID 58882053) has the molecular formula C18H19NO3
and a molecular weight of 297.35 g/mol. Its IUPAC name is 4-hydroxy-1,5,6-trimethyl-3-[(E)-3-(3-methylphenyl)prop-2-enoyl]pyridin-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-1,5,6-trimethyl-3-[(E)-3-(3-methylphenyl)prop-2-enoyl]pyridin-2-one |
| PubChem CID | 58882053 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 4-hydroxy-1,5,6-trimethyl-3-[(E)-3-(3-methylphenyl)prop-2-enoyl]pyridin-2-one |
| SMILES | Cc1cccc(/C=C/C(=O)c2c(O)c(C)c(C)n(C)c2=O)c1 |
| InChI | InChI=1S/C18H19NO3/c1-11-6-5-7-14(10-11)8-9-15(20)16-17(21)12(2)13(3)19(4)18(16)22/h5-10,21H,1-4H3/b9-8+ |
| InChIKey | KXUFLMIQHYPEIB-CMDGGOBGSA-N |
| XLogP | 2.91 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-1,5,6-trimethyl-3-[(E)-3-(3-methylphenyl)prop-2-enoyl]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-1,5,6-trimethyl-3-[(E)-3-(3-methylphenyl)prop-2-enoyl]pyridin-2-one?
The IUPAC name of 4-hydroxy-1,5,6-trimethyl-3-[(E)-3-(3-methylphenyl)prop-2-enoyl]pyridin-2-one (CID 58882053) is 4-hydroxy-1,5,6-trimethyl-3-[(E)-3-(3-methylphenyl)prop-2-enoyl]pyridin-2-one.
What is the SMILES notation for 4-hydroxy-1,5,6-trimethyl-3-[(E)-3-(3-methylphenyl)prop-2-enoyl]pyridin-2-one?
The canonical SMILES for 4-hydroxy-1,5,6-trimethyl-3-[(E)-3-(3-methylphenyl)prop-2-enoyl]pyridin-2-one is Cc1cccc(/C=C/C(=O)c2c(O)c(C)c(C)n(C)c2=O)c1.
What is the InChIKey of 4-hydroxy-1,5,6-trimethyl-3-[(E)-3-(3-methylphenyl)prop-2-enoyl]pyridin-2-one?
The InChIKey is KXUFLMIQHYPEIB-CMDGGOBGSA-N. The full InChI is InChI=1S/C18H19NO3/c1-11-6-5-7-14(10-11)8-9-15(20)16-17(21)12(2)13(3)19(4)18(16)22/h5-10,21H,1-4H3/b9-8+.
What are the key properties of 4-hydroxy-1,5,6-trimethyl-3-[(E)-3-(3-methylphenyl)prop-2-enoyl]pyridin-2-one?
4-hydroxy-1,5,6-trimethyl-3-[(E)-3-(3-methylphenyl)prop-2-enoyl]pyridin-2-one has a molecular weight of 297.35 g/mol, XLogP of 2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-1,5,6-trimethyl-3-[(E)-3-(3-methylphenyl)prop-2-enoyl]pyridin-2-one is sourced from PubChem (CID 58882053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).