C7H3F5N2S — CID 58882079
2-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-yl]acetonitrile (PubChem CID 58882079) has the molecular formula C7H3F5N2S and a molecular weight of 242.17 g/mol. Its IUPAC name is 2-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-yl]acetonitrile.
| Compound Name | 2-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-yl]acetonitrile |
|---|---|
| PubChem CID | 58882079 |
| Molecular Formula | C7H3F5N2S |
| Molecular Weight | 242.17 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 2-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-yl]acetonitrile |
| SMILES | N#CCc1nc(C(F)(F)C(F)(F)F)cs1 |
| InChI | InChI=1S/C7H3F5N2S/c8-6(9,7(10,11)12)4-3-15-5(14-4)1-2-13/h3H,1H2 |
| InChIKey | QTLBZQFOOWKSOZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.17 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|