About 2-(2-phenyl-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazol-5-amine
2-(2-phenyl-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazol-5-amine (PubChem CID 58882240) has the molecular formula C29H20N4
and a molecular weight of 424.51 g/mol. Its IUPAC name is 2-(2-phenyl-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazol-5-amine.
Molecular Properties
| Compound Name | 2-(2-phenyl-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazol-5-amine |
| PubChem CID | 58882240 |
| Molecular Formula | C29H20N4 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 2-(2-phenyl-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazol-5-amine |
| SMILES | Nc1ccc2c3ccccc3c3[nH]c(-c4c(-c5ccccc5)[nH]c5ccccc45)nc3c2c1 |
| InChI | InChI=1S/C29H20N4/c30-18-14-15-20-19-10-4-5-11-21(19)27-28(23(20)16-18)33-29(32-27)25-22-12-6-7-13-24(22)31-26(25)17-8-2-1-3-9-17/h1-16,31H,30H2,(H,32,33) |
| InChIKey | JSHNFZFDYSNEGN-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 70.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-phenyl-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-phenyl-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazol-5-amine?
The IUPAC name of 2-(2-phenyl-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazol-5-amine (CID 58882240) is 2-(2-phenyl-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazol-5-amine.
What is the SMILES notation for 2-(2-phenyl-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazol-5-amine?
The canonical SMILES for 2-(2-phenyl-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazol-5-amine is Nc1ccc2c3ccccc3c3[nH]c(-c4c(-c5ccccc5)[nH]c5ccccc45)nc3c2c1.
What is the InChIKey of 2-(2-phenyl-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazol-5-amine?
The InChIKey is JSHNFZFDYSNEGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H20N4/c30-18-14-15-20-19-10-4-5-11-21(19)27-28(23(20)16-18)33-29(32-27)25-22-12-6-7-13-24(22)31-26(25)17-8-2-1-3-9-17/h1-16,31H,30H2,(H,32,33).
What are the key properties of 2-(2-phenyl-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazol-5-amine?
2-(2-phenyl-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazol-5-amine has a molecular weight of 424.51 g/mol, XLogP of 7.27, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-phenyl-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazol-5-amine is sourced from PubChem (CID 58882240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).