About 2-(5-methoxy-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole
2-(5-methoxy-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole (PubChem CID 58882264) has the molecular formula C24H17N3O
and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-(5-methoxy-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole.
Molecular Properties
| Compound Name | 2-(5-methoxy-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole |
| PubChem CID | 58882264 |
| Molecular Formula | C24H17N3O |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 2-(5-methoxy-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole |
| SMILES | COc1ccc2[nH]cc(-c3nc4c5ccccc5c5ccccc5c4[nH]3)c2c1 |
| InChI | InChI=1S/C24H17N3O/c1-28-14-10-11-21-19(12-14)20(13-25-21)24-26-22-17-8-4-2-6-15(17)16-7-3-5-9-18(16)23(22)27-24/h2-13,25H,1H3,(H,26,27) |
| InChIKey | AGNSJKNAXIYJMN-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 53.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-methoxy-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methoxy-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole?
The IUPAC name of 2-(5-methoxy-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole (CID 58882264) is 2-(5-methoxy-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole.
What is the SMILES notation for 2-(5-methoxy-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole?
The canonical SMILES for 2-(5-methoxy-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole is COc1ccc2[nH]cc(-c3nc4c5ccccc5c5ccccc5c4[nH]3)c2c1.
What is the InChIKey of 2-(5-methoxy-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole?
The InChIKey is AGNSJKNAXIYJMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17N3O/c1-28-14-10-11-21-19(12-14)20(13-25-21)24-26-22-17-8-4-2-6-15(17)16-7-3-5-9-18(16)23(22)27-24/h2-13,25H,1H3,(H,26,27).
What are the key properties of 2-(5-methoxy-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole?
2-(5-methoxy-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole has a molecular weight of 363.42 g/mol, XLogP of 6.03, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methoxy-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole is sourced from PubChem (CID 58882264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).