C13H16N2 — CID 588824
2-ethyl-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 588824) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-ethyl-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 2-ethyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 588824 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-ethyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | CCN1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C13H16N2/c1-2-15-8-7-13-11(9-15)10-5-3-4-6-12(10)14-13/h3-6,14H,2,7-9H2,1H3 |
| InChIKey | MYUAGMGKBGUWEN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|