C26H33FN2O6Si — CID 58882945
ethyl 7-[[4-fluoro-2-(2-trimethylsilylethoxymethoxymethyl)phenyl]methyl]-4-hydroxy-1-methyl-2-oxo-1,5-naphthyridine-3-carboxylate (PubChem CID 58882945) has the molecular formula C26H33FN2O6Si and a molecular weight of 516.64 g/mol. Its IUPAC name is ethyl 7-[[4-fluoro-2-(2-trimethylsilylethoxymethoxymethyl)phenyl]methyl]-4-hydroxy-1-methyl-2-oxo-1,5-naphthyridine-3-carboxylate.
| Compound Name | ethyl 7-[[4-fluoro-2-(2-trimethylsilylethoxymethoxymethyl)phenyl]methyl]-4-hydroxy-1-methyl-2-oxo-1,5-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 58882945 |
| Molecular Formula | C26H33FN2O6Si |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | ethyl 7-[[4-fluoro-2-(2-trimethylsilylethoxymethoxymethyl)phenyl]methyl]-4-hydroxy-1-methyl-2-oxo-1,5-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(O)c2ncc(Cc3ccc(F)cc3COCOCC[Si](C)(C)C)cc2n(C)c1=O |
| InChI | InChI=1S/C26H33FN2O6Si/c1-6-35-26(32)22-24(30)23-21(29(2)25(22)31)12-17(14-28-23)11-18-7-8-20(27)13-19(18)15-34-16-33-9-10-36(3,4)5/h7-8,12-14,30H,6,9-11,15-16H2,1-5H3 |
| InChIKey | JUMKETPVFBTRMR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|