About 6-butyl-3-[4-(diethylamino)-2-methylphenyl]imino-2,5-dimethylpyrazolo[1,5-a]pyridin-7-one
6-butyl-3-[4-(diethylamino)-2-methylphenyl]imino-2,5-dimethylpyrazolo[1,5-a]pyridin-7-one (PubChem CID 58883157) has the molecular formula C24H32N4O
and a molecular weight of 392.55 g/mol. Its IUPAC name is 6-butyl-3-[4-(diethylamino)-2-methylphenyl]imino-2,5-dimethylpyrazolo[1,5-a]pyridin-7-one.
Molecular Properties
| Compound Name | 6-butyl-3-[4-(diethylamino)-2-methylphenyl]imino-2,5-dimethylpyrazolo[1,5-a]pyridin-7-one |
| PubChem CID | 58883157 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | 6-butyl-3-[4-(diethylamino)-2-methylphenyl]imino-2,5-dimethylpyrazolo[1,5-a]pyridin-7-one |
| SMILES | CCCCc1c(C)cc2n(c1=O)N=C(C)/C2=N\c1ccc(N(CC)CC)cc1C |
| InChI | InChI=1S/C24H32N4O/c1-7-10-11-20-16(4)15-22-23(18(6)26-28(22)24(20)29)25-21-13-12-19(14-17(21)5)27(8-2)9-3/h12-15H,7-11H2,1-6H3/b25-23+ |
| InChIKey | ISHUJZPTPLZHFU-WJTDDFOZSA-N |
| XLogP | 5.01 |
| TPSA | 49.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-butyl-3-[4-(diethylamino)-2-methylphenyl]imino-2,5-dimethylpyrazolo[1,5-a]pyridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butyl-3-[4-(diethylamino)-2-methylphenyl]imino-2,5-dimethylpyrazolo[1,5-a]pyridin-7-one?
The IUPAC name of 6-butyl-3-[4-(diethylamino)-2-methylphenyl]imino-2,5-dimethylpyrazolo[1,5-a]pyridin-7-one (CID 58883157) is 6-butyl-3-[4-(diethylamino)-2-methylphenyl]imino-2,5-dimethylpyrazolo[1,5-a]pyridin-7-one.
What is the SMILES notation for 6-butyl-3-[4-(diethylamino)-2-methylphenyl]imino-2,5-dimethylpyrazolo[1,5-a]pyridin-7-one?
The canonical SMILES for 6-butyl-3-[4-(diethylamino)-2-methylphenyl]imino-2,5-dimethylpyrazolo[1,5-a]pyridin-7-one is CCCCc1c(C)cc2n(c1=O)N=C(C)/C2=N\c1ccc(N(CC)CC)cc1C.
What is the InChIKey of 6-butyl-3-[4-(diethylamino)-2-methylphenyl]imino-2,5-dimethylpyrazolo[1,5-a]pyridin-7-one?
The InChIKey is ISHUJZPTPLZHFU-WJTDDFOZSA-N. The full InChI is InChI=1S/C24H32N4O/c1-7-10-11-20-16(4)15-22-23(18(6)26-28(22)24(20)29)25-21-13-12-19(14-17(21)5)27(8-2)9-3/h12-15H,7-11H2,1-6H3/b25-23+.
What are the key properties of 6-butyl-3-[4-(diethylamino)-2-methylphenyl]imino-2,5-dimethylpyrazolo[1,5-a]pyridin-7-one?
6-butyl-3-[4-(diethylamino)-2-methylphenyl]imino-2,5-dimethylpyrazolo[1,5-a]pyridin-7-one has a molecular weight of 392.55 g/mol, XLogP of 5.01, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butyl-3-[4-(diethylamino)-2-methylphenyl]imino-2,5-dimethylpyrazolo[1,5-a]pyridin-7-one is sourced from PubChem (CID 58883157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).