C27H36N8O3 — CID 58883264
2,2-dimethylpropyl N-[4-[[1-[2-[(3S,5R)-4-acetyl-3,5-dimethylpiperazin-1-yl]-4-pyridinyl]-1,2,4-triazol-3-yl]amino]phenyl]carbamate (PubChem CID 58883264) has the molecular formula C27H36N8O3 and a molecular weight of 520.64 g/mol. Its IUPAC name is 2,2-dimethylpropyl N-[4-[[1-[2-[(3S,5R)-4-acetyl-3,5-dimethylpiperazin-1-yl]-4-pyridinyl]-1,2,4-triazol-3-yl]amino]phenyl]carbamate.
| Compound Name | 2,2-dimethylpropyl N-[4-[[1-[2-[(3S,5R)-4-acetyl-3,5-dimethylpiperazin-1-yl]-4-pyridinyl]-1,2,4-triazol-3-yl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 58883264 |
| Molecular Formula | C27H36N8O3 |
| Molecular Weight | 520.64 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | 2,2-dimethylpropyl N-[4-[[1-[2-[(3S,5R)-4-acetyl-3,5-dimethylpiperazin-1-yl]-4-pyridinyl]-1,2,4-triazol-3-yl]amino]phenyl]carbamate |
| SMILES | CC(=O)N1[C@H](C)CN(c2cc(-n3cnc(Nc4ccc(NC(=O)OCC(C)(C)C)cc4)n3)ccn2)C[C@@H]1C |
| InChI | InChI=1S/C27H36N8O3/c1-18-14-33(15-19(2)35(18)20(3)36)24-13-23(11-12-28-24)34-17-29-25(32-34)30-21-7-9-22(10-8-21)31-26(37)38-16-27(4,5)6/h7-13,17-19H,14-16H2,1-6H3,(H,30,32)(H,31,37)/t18-,19+ |
| InChIKey | HVQQIAMCYGRIKM-KDURUIRLSA-N |
| XLogP | 4.45 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.64 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |