About 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine
2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine (PubChem CID 58883308) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine |
| PubChem CID | 58883308 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine |
| SMILES | CCNc1ncnn1C1CCCCC1 |
| InChI | InChI=1S/C10H18N4/c1-2-11-10-12-8-13-14(10)9-6-4-3-5-7-9/h8-9H,2-7H2,1H3,(H,11,12,13) |
| InChIKey | IFPOPYKKUCLAJS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine?
The IUPAC name of 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine (CID 58883308) is 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine.
What is the SMILES notation for 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine?
The canonical SMILES for 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine is CCNc1ncnn1C1CCCCC1.
What is the InChIKey of 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine?
The InChIKey is IFPOPYKKUCLAJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4/c1-2-11-10-12-8-13-14(10)9-6-4-3-5-7-9/h8-9H,2-7H2,1H3,(H,11,12,13).
What are the key properties of 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine?
2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine has a molecular weight of 194.28 g/mol, XLogP of 2.22, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine is sourced from PubChem (CID 58883308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).