C20H24N6 — CID 58883369
4-(3-anilino-1,2,4-triazol-1-yl)-N-cyclohexyl-N-methylpyridin-2-amine (PubChem CID 58883369) has the molecular formula C20H24N6 and a molecular weight of 348.45 g/mol. Its IUPAC name is 4-(3-anilino-1,2,4-triazol-1-yl)-N-cyclohexyl-N-methylpyridin-2-amine.
| Compound Name | 4-(3-anilino-1,2,4-triazol-1-yl)-N-cyclohexyl-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 58883369 |
| Molecular Formula | C20H24N6 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 4-(3-anilino-1,2,4-triazol-1-yl)-N-cyclohexyl-N-methylpyridin-2-amine |
| SMILES | CN(c1cc(-n2cnc(Nc3ccccc3)n2)ccn1)C1CCCCC1 |
| InChI | InChI=1S/C20H24N6/c1-25(17-10-6-3-7-11-17)19-14-18(12-13-21-19)26-15-22-20(24-26)23-16-8-4-2-5-9-16/h2,4-5,8-9,12-15,17H,3,6-7,10-11H2,1H3,(H,23,24) |
| InChIKey | MZLKNCXEFSNQQA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |