C26H20N2O7S — CID 58883598
methyl 14-methyl-10-[4-methyl-2-(trioxidanylsulfanyl)anilino]-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-16-carboxylate (PubChem CID 58883598) has the molecular formula C26H20N2O7S and a molecular weight of 504.52 g/mol. Its IUPAC name is methyl 14-methyl-10-[4-methyl-2-(trioxidanylsulfanyl)anilino]-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-16-carboxylate.
| Compound Name | methyl 14-methyl-10-[4-methyl-2-(trioxidanylsulfanyl)anilino]-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-16-carboxylate |
|---|---|
| PubChem CID | 58883598 |
| Molecular Formula | C26H20N2O7S |
| Molecular Weight | 504.52 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | methyl 14-methyl-10-[4-methyl-2-(trioxidanylsulfanyl)anilino]-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-16-carboxylate |
| SMILES | COC(=O)c1c2c3c(c(Nc4ccc(C)cc4SOOO)ccc3n(C)c1=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C26H20N2O7S/c1-13-8-9-16(19(12-13)36-35-34-32)27-17-10-11-18-22-20(23(26(31)33-3)25(30)28(18)2)14-6-4-5-7-15(14)24(29)21(17)22/h4-12,27,32H,1-3H3 |
| InChIKey | GYOLGOSVXJHDKM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|