C26H18N2O6 — CID 58883599
4-[(16-ethoxycarbonyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]benzoic acid (PubChem CID 58883599) has the molecular formula C26H18N2O6 and a molecular weight of 454.44 g/mol. Its IUPAC name is 4-[(16-ethoxycarbonyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]benzoic acid.
| Compound Name | 4-[(16-ethoxycarbonyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 58883599 |
| Molecular Formula | C26H18N2O6 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 4-[(16-ethoxycarbonyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]benzoic acid |
| SMILES | CCOC(=O)c1c2c3c(c(Nc4ccc(C(=O)O)cc4)ccc3[nH]c1=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C26H18N2O6/c1-2-34-26(33)22-19-15-5-3-4-6-16(15)23(29)21-18(12-11-17(20(19)21)28-24(22)30)27-14-9-7-13(8-10-14)25(31)32/h3-12,27H,2H2,1H3,(H,28,30)(H,31,32) |
| InChIKey | SQXAQZZBUZDUJY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 125.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|