C43H40N2O4 — CID 58883931
2-N,2-N,7-N,7-N-tetrakis(4-methoxyphenyl)-9,9-dimethylfluorene-2,7-diamine (PubChem CID 58883931) has the molecular formula C43H40N2O4 and a molecular weight of 648.80 g/mol. Its IUPAC name is 2-N,2-N,7-N,7-N-tetrakis(4-methoxyphenyl)-9,9-dimethylfluorene-2,7-diamine.
| Compound Name | 2-N,2-N,7-N,7-N-tetrakis(4-methoxyphenyl)-9,9-dimethylfluorene-2,7-diamine |
|---|---|
| PubChem CID | 58883931 |
| Molecular Formula | C43H40N2O4 |
| Molecular Weight | 648.80 g/mol |
| Exact Mass | 648.30 |
| IUPAC Name | 2-N,2-N,7-N,7-N-tetrakis(4-methoxyphenyl)-9,9-dimethylfluorene-2,7-diamine |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc3c(c2)C(C)(C)c2cc(N(c4ccc(OC)cc4)c4ccc(OC)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C43H40N2O4/c1-43(2)41-27-33(44(29-7-17-35(46-3)18-8-29)30-9-19-36(47-4)20-10-30)15-25-39(41)40-26-16-34(28-42(40)43)45(31-11-21-37(48-5)22-12-31)32-13-23-38(49-6)24-14-32/h7-28H,1-6H3 |
| InChIKey | GYOKPJXXAQJWDW-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.80 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |