C19H19N5 — CID 58884491
3-methyl-3,6,21,22,23-pentazapentacyclo[17.2.1.15,8.07,12.015,20]tricosa-1(21),5,7(12),8,10,15(20),16,18-octaene (PubChem CID 58884491) has the molecular formula C19H19N5 and a molecular weight of 317.40 g/mol. Its IUPAC name is 3-methyl-3,6,21,22,23-pentazapentacyclo[17.2.1.15,8.07,12.015,20]tricosa-1(21),5,7(12),8,10,15(20),16,18-octaene.
| Compound Name | 3-methyl-3,6,21,22,23-pentazapentacyclo[17.2.1.15,8.07,12.015,20]tricosa-1(21),5,7(12),8,10,15(20),16,18-octaene |
|---|---|
| PubChem CID | 58884491 |
| Molecular Formula | C19H19N5 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 3-methyl-3,6,21,22,23-pentazapentacyclo[17.2.1.15,8.07,12.015,20]tricosa-1(21),5,7(12),8,10,15(20),16,18-octaene |
| SMILES | CN1Cc2nc3c(cccc3[nH]2)CCc2cccc3[nH]c(nc23)C1 |
| InChI | InChI=1S/C19H19N5/c1-24-10-16-20-14-6-2-4-12(18(14)22-16)8-9-13-5-3-7-15-19(13)23-17(11-24)21-15/h2-7H,8-11H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | YXHLDQBZPVHERZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |