C27H25N5 — CID 58884525
1-(1-methyl-4,7-diphenylbenzimidazol-2-yl)-N-(1,3,5-trimethylpyrazol-4-yl)methanimine (PubChem CID 58884525) has the molecular formula C27H25N5 and a molecular weight of 419.53 g/mol. Its IUPAC name is 1-(1-methyl-4,7-diphenylbenzimidazol-2-yl)-N-(1,3,5-trimethylpyrazol-4-yl)methanimine.
| Compound Name | 1-(1-methyl-4,7-diphenylbenzimidazol-2-yl)-N-(1,3,5-trimethylpyrazol-4-yl)methanimine |
|---|---|
| PubChem CID | 58884525 |
| Molecular Formula | C27H25N5 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 1-(1-methyl-4,7-diphenylbenzimidazol-2-yl)-N-(1,3,5-trimethylpyrazol-4-yl)methanimine |
| SMILES | Cc1nn(C)c(C)c1/N=C/c1nc2c(-c3ccccc3)ccc(-c3ccccc3)c2n1C |
| InChI | InChI=1S/C27H25N5/c1-18-25(19(2)32(4)30-18)28-17-24-29-26-22(20-11-7-5-8-12-20)15-16-23(27(26)31(24)3)21-13-9-6-10-14-21/h5-17H,1-4H3/b28-17+ |
| InChIKey | KEEHJOUPQPOAJW-OGLMXYFKSA-N |
| XLogP | 6.01 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|