About 4-ethyl-1,3-oxazole-2-carbaldehyde
4-ethyl-1,3-oxazole-2-carbaldehyde (PubChem CID 58884863) has the molecular formula C6H7NO2
and a molecular weight of 125.13 g/mol. Its IUPAC name is 4-ethyl-1,3-oxazole-2-carbaldehyde.
Molecular Properties
| Compound Name | 4-ethyl-1,3-oxazole-2-carbaldehyde |
| PubChem CID | 58884863 |
| Molecular Formula | C6H7NO2 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.05 |
| IUPAC Name | 4-ethyl-1,3-oxazole-2-carbaldehyde |
| SMILES | CCc1coc(C=O)n1 |
| InChI | InChI=1S/C6H7NO2/c1-2-5-4-9-6(3-8)7-5/h3-4H,2H2,1H3 |
| InChIKey | NTBDUELOCYUWAZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-1,3-oxazole-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1,3-oxazole-2-carbaldehyde?
The IUPAC name of 4-ethyl-1,3-oxazole-2-carbaldehyde (CID 58884863) is 4-ethyl-1,3-oxazole-2-carbaldehyde.
What is the SMILES notation for 4-ethyl-1,3-oxazole-2-carbaldehyde?
The canonical SMILES for 4-ethyl-1,3-oxazole-2-carbaldehyde is CCc1coc(C=O)n1.
What is the InChIKey of 4-ethyl-1,3-oxazole-2-carbaldehyde?
The InChIKey is NTBDUELOCYUWAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2/c1-2-5-4-9-6(3-8)7-5/h3-4H,2H2,1H3.
What are the key properties of 4-ethyl-1,3-oxazole-2-carbaldehyde?
4-ethyl-1,3-oxazole-2-carbaldehyde has a molecular weight of 125.13 g/mol, XLogP of 1.05, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1,3-oxazole-2-carbaldehyde is sourced from PubChem (CID 58884863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).