C8H14NOP — CID 58885307
2-phosphanyl-3,3a,4,6,7,7a-hexahydro-1H-isoindol-5-one (PubChem CID 58885307) has the molecular formula C8H14NOP and a molecular weight of 171.18 g/mol. Its IUPAC name is 2-phosphanyl-3,3a,4,6,7,7a-hexahydro-1H-isoindol-5-one.
| Compound Name | 2-phosphanyl-3,3a,4,6,7,7a-hexahydro-1H-isoindol-5-one |
|---|---|
| PubChem CID | 58885307 |
| Molecular Formula | C8H14NOP |
| Molecular Weight | 171.18 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 2-phosphanyl-3,3a,4,6,7,7a-hexahydro-1H-isoindol-5-one |
| SMILES | O=C1CCC2CN(P)CC2C1 |
| InChI | InChI=1S/C8H14NOP/c10-8-2-1-6-4-9(11)5-7(6)3-8/h6-7H,1-5,11H2 |
| InChIKey | AJIOFSXQQLLAON-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.18 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|