C9H16NP — CID 58885312
(6-methylidene-3,3a,4,5,7,7a-hexahydro-1H-isoindol-2-yl)phosphane (PubChem CID 58885312) has the molecular formula C9H16NP and a molecular weight of 169.21 g/mol. Its IUPAC name is (6-methylidene-3,3a,4,5,7,7a-hexahydro-1H-isoindol-2-yl)phosphane.
| Compound Name | (6-methylidene-3,3a,4,5,7,7a-hexahydro-1H-isoindol-2-yl)phosphane |
|---|---|
| PubChem CID | 58885312 |
| Molecular Formula | C9H16NP |
| Molecular Weight | 169.21 g/mol |
| Exact Mass | 169.10 |
| IUPAC Name | (6-methylidene-3,3a,4,5,7,7a-hexahydro-1H-isoindol-2-yl)phosphane |
| SMILES | C=C1CCC2CN(P)CC2C1 |
| InChI | InChI=1S/C9H16NP/c1-7-2-3-8-5-10(11)6-9(8)4-7/h8-9H,1-6,11H2 |
| InChIKey | ISGFLPNYGPHRQN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|