C9H19N2P — CID 58885313
N-methyl-2-phosphanyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine (PubChem CID 58885313) has the molecular formula C9H19N2P and a molecular weight of 186.24 g/mol. Its IUPAC name is N-methyl-2-phosphanyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine.
| Compound Name | N-methyl-2-phosphanyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
|---|---|
| PubChem CID | 58885313 |
| Molecular Formula | C9H19N2P |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | N-methyl-2-phosphanyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
| SMILES | CNC1CCC2CN(P)CC2C1 |
| InChI | InChI=1S/C9H19N2P/c1-10-9-3-2-7-5-11(12)6-8(7)4-9/h7-10H,2-6,12H2,1H3 |
| InChIKey | FLLSAZPBOVQNHD-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|