C26H47Cl2NSiZr — CID 58885693
carbanide;dichlorozirconium(2+);(5,8-dimethyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-10-yl)-dimethyl-(2-methylcyclopentyl)silane (PubChem CID 58885693) has the molecular formula C26H47Cl2NSiZr and a molecular weight of 563.89 g/mol. Its IUPAC name is carbanide;dichlorozirconium(2+);(5,8-dimethyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-10-yl)-dimethyl-(2-methylcyclopentyl)silane.
| Compound Name | carbanide;dichlorozirconium(2+);(5,8-dimethyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-10-yl)-dimethyl-(2-methylcyclopentyl)silane |
|---|---|
| PubChem CID | 58885693 |
| Molecular Formula | C26H47Cl2NSiZr |
| Molecular Weight | 563.89 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | carbanide;dichlorozirconium(2+);(5,8-dimethyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-10-yl)-dimethyl-(2-methylcyclopentyl)silane |
| SMILES | C[C-]1CCCC1[Si](C)(C)C1C2CCCCC2C2C1C1CC(C)CCC1N2C.Cl[Zr+2]Cl.[CH3-] |
| InChI | InChI=1S/C25H44NSi.CH3.2ClH.Zr/c1-16-13-14-21-20(15-16)23-24(26(21)3)18-10-6-7-11-19(18)25(23)27(4,5)22-12-8-9-17(22)2;;;;/h16,18-25H,6-15H2,1-5H3;1H3;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | NXEPDHMUHLFKKQ-UHFFFAOYSA-L |
| XLogP | 8.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.89 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|