C27H36Cl2N4O3 — CID 58886264
6-amino-5-[(2,6-dichlorophenyl)methoxy]-N-[8-(2-ethylbutyl)-1-oxa-8-azaspiro[4.5]decan-3-yl]pyridine-3-carboxamide (PubChem CID 58886264) has the molecular formula C27H36Cl2N4O3 and a molecular weight of 535.52 g/mol. Its IUPAC name is 6-amino-5-[(2,6-dichlorophenyl)methoxy]-N-[8-(2-ethylbutyl)-1-oxa-8-azaspiro[4.5]decan-3-yl]pyridine-3-carboxamide.
| Compound Name | 6-amino-5-[(2,6-dichlorophenyl)methoxy]-N-[8-(2-ethylbutyl)-1-oxa-8-azaspiro[4.5]decan-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58886264 |
| Molecular Formula | C27H36Cl2N4O3 |
| Molecular Weight | 535.52 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | 6-amino-5-[(2,6-dichlorophenyl)methoxy]-N-[8-(2-ethylbutyl)-1-oxa-8-azaspiro[4.5]decan-3-yl]pyridine-3-carboxamide |
| SMILES | CCC(CC)CN1CCC2(CC1)CC(NC(=O)c1cnc(N)c(OCc3c(Cl)cccc3Cl)c1)CO2 |
| InChI | InChI=1S/C27H36Cl2N4O3/c1-3-18(4-2)15-33-10-8-27(9-11-33)13-20(16-36-27)32-26(34)19-12-24(25(30)31-14-19)35-17-21-22(28)6-5-7-23(21)29/h5-7,12,14,18,20H,3-4,8-11,13,15-17H2,1-2H3,(H2,30,31)(H,32,34) |
| InChIKey | MOQMMWFPANFKPF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|