C23H24ClF2N5O3S — CID 58886503
N-[4-[5-amino-6-[1-(2-chloro-3,6-difluorophenyl)ethoxy]pyrazin-2-yl]phenyl]-2-(cyclopropylamino)ethanesulfonamide (PubChem CID 58886503) has the molecular formula C23H24ClF2N5O3S and a molecular weight of 523.99 g/mol. Its IUPAC name is N-[4-[5-amino-6-[1-(2-chloro-3,6-difluorophenyl)ethoxy]pyrazin-2-yl]phenyl]-2-(cyclopropylamino)ethanesulfonamide.
| Compound Name | N-[4-[5-amino-6-[1-(2-chloro-3,6-difluorophenyl)ethoxy]pyrazin-2-yl]phenyl]-2-(cyclopropylamino)ethanesulfonamide |
|---|---|
| PubChem CID | 58886503 |
| Molecular Formula | C23H24ClF2N5O3S |
| Molecular Weight | 523.99 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | N-[4-[5-amino-6-[1-(2-chloro-3,6-difluorophenyl)ethoxy]pyrazin-2-yl]phenyl]-2-(cyclopropylamino)ethanesulfonamide |
| SMILES | CC(Oc1nc(-c2ccc(NS(=O)(=O)CCNC3CC3)cc2)cnc1N)c1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C23H24ClF2N5O3S/c1-13(20-17(25)8-9-18(26)21(20)24)34-23-22(27)29-12-19(30-23)14-2-4-16(5-3-14)31-35(32,33)11-10-28-15-6-7-15/h2-5,8-9,12-13,15,28,31H,6-7,10-11H2,1H3,(H2,27,29) |
| InChIKey | VPEKFZMGWMRBKD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.99 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|